C17H20ClN5O2S — CID 142674275
3-chloro-N-[2-(diethylamino)benzotriazol-5-yl]-2-methylbenzenesulfonamide (PubChem CID 142674275) has the molecular formula C17H20ClN5O2S and a molecular weight of 393.90 g/mol. Its IUPAC name is 3-chloro-N-[2-(diethylamino)benzotriazol-5-yl]-2-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[2-(diethylamino)benzotriazol-5-yl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 142674275 |
| Molecular Formula | C17H20ClN5O2S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-chloro-N-[2-(diethylamino)benzotriazol-5-yl]-2-methylbenzenesulfonamide |
| SMILES | CCN(CC)n1nc2ccc(NS(=O)(=O)c3cccc(Cl)c3C)cc2n1 |
| InChI | InChI=1S/C17H20ClN5O2S/c1-4-22(5-2)23-19-15-10-9-13(11-16(15)20-23)21-26(24,25)17-8-6-7-14(18)12(17)3/h6-11,21H,4-5H2,1-3H3 |
| InChIKey | AGZSDDOQCABZGH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |