C12H11FN2 — CID 142674305
1-(1,2-dihydroazet-3-ylmethyl)-5-fluoroindole (PubChem CID 142674305) has the molecular formula C12H11FN2 and a molecular weight of 202.23 g/mol. Its IUPAC name is 1-(1,2-dihydroazet-3-ylmethyl)-5-fluoroindole.
| Compound Name | 1-(1,2-dihydroazet-3-ylmethyl)-5-fluoroindole |
|---|---|
| PubChem CID | 142674305 |
| Molecular Formula | C12H11FN2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-(1,2-dihydroazet-3-ylmethyl)-5-fluoroindole |
| SMILES | Fc1ccc2c(ccn2CC2=CNC2)c1 |
| InChI | InChI=1S/C12H11FN2/c13-11-1-2-12-10(5-11)3-4-15(12)8-9-6-14-7-9/h1-6,14H,7-8H2 |
| InChIKey | GYGWAUVAIGVHLZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |