C20H20N4O4S2 — CID 142674396
6-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(hexylideneamino)-7-hydroxythieno[3,2-b]pyridin-5-one (PubChem CID 142674396) has the molecular formula C20H20N4O4S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 6-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(hexylideneamino)-7-hydroxythieno[3,2-b]pyridin-5-one.
| Compound Name | 6-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(hexylideneamino)-7-hydroxythieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 142674396 |
| Molecular Formula | C20H20N4O4S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 6-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(hexylideneamino)-7-hydroxythieno[3,2-b]pyridin-5-one |
| SMILES | CCCCCC=Nn1c(=O)c(C2=NS(=O)(=O)c3ccccc3N2)c(O)c2sccc21 |
| InChI | InChI=1S/C20H20N4O4S2/c1-2-3-4-7-11-21-24-14-10-12-29-18(14)17(25)16(20(24)26)19-22-13-8-5-6-9-15(13)30(27,28)23-19/h5-6,8-12,25H,2-4,7H2,1H3,(H,22,23) |
| InChIKey | OGTSJHCALXWVSY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|