About 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol
2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol (PubChem CID 142674429) has the molecular formula C12H11FO3
and a molecular weight of 222.21 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol.
Molecular Properties
| Compound Name | 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol |
| PubChem CID | 142674429 |
| Molecular Formula | C12H11FO3 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol |
| SMILES | OC1COC(C#Cc2ccccc2F)C1O |
| InChI | InChI=1S/C12H11FO3/c13-9-4-2-1-3-8(9)5-6-11-12(15)10(14)7-16-11/h1-4,10-12,14-15H,7H2 |
| InChIKey | NJMYTJKMTMMPPT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol?
The IUPAC name of 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol (CID 142674429) is 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol.
What is the SMILES notation for 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol?
The canonical SMILES for 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol is OC1COC(C#Cc2ccccc2F)C1O.
What is the InChIKey of 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol?
The InChIKey is NJMYTJKMTMMPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FO3/c13-9-4-2-1-3-8(9)5-6-11-12(15)10(14)7-16-11/h1-4,10-12,14-15H,7H2.
What are the key properties of 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol?
2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol has a molecular weight of 222.21 g/mol, XLogP of 0.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-fluorophenyl)ethynyl]oxolane-3,4-diol is sourced from PubChem (CID 142674429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).