C16H16F3NO — CID 142674854
2-methyl-5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde (PubChem CID 142674854) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-methyl-5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde.
| Compound Name | 2-methyl-5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 142674854 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-methyl-5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde |
| SMILES | Cc1c(C=O)cc(C(C)C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3NO/c1-10(2)15-8-12(9-21)11(3)20(15)14-7-5-4-6-13(14)16(17,18)19/h4-10H,1-3H3 |
| InChIKey | PRFBYYCQTHNSNW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|