C15H26N2Rh — CID 142675127
(1,3-dicyclohexylimidazolidin-2-ylidene)rhodium (PubChem CID 142675127) has the molecular formula C15H26N2Rh and a molecular weight of 337.29 g/mol. Its IUPAC name is (1,3-dicyclohexylimidazolidin-2-ylidene)rhodium.
| Compound Name | (1,3-dicyclohexylimidazolidin-2-ylidene)rhodium |
|---|---|
| PubChem CID | 142675127 |
| Molecular Formula | C15H26N2Rh |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (1,3-dicyclohexylimidazolidin-2-ylidene)rhodium |
| SMILES | [Rh]=C1N(C2CCCCC2)CCN1C1CCCCC1 |
| InChI | InChI=1S/C15H26N2.Rh/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15;/h14-15H,1-12H2; |
| InChIKey | RWEKCIFYYHIVCL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |