About dihydrogen borate;trimethylazanium
dihydrogen borate;trimethylazanium (PubChem CID 142675520) has the molecular formula C3H12BNO3
and a molecular weight of 120.94 g/mol. Its IUPAC name is dihydrogen borate;trimethylazanium.
Molecular Properties
| Compound Name | dihydrogen borate;trimethylazanium |
| PubChem CID | 142675520 |
| Molecular Formula | C3H12BNO3 |
| Molecular Weight | 120.94 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | dihydrogen borate;trimethylazanium |
| SMILES | C[NH+](C)C.[O-]B(O)O |
| InChI | InChI=1S/C3H9N.BH2O3/c1-4(2)3;2-1(3)4/h1-3H3;2-3H/q;-1/p+1 |
| InChIKey | FZZGAKVLPWYYIU-UHFFFAOYSA-O |
| XLogP | -3.92 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.94 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dihydrogen borate;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydrogen borate;trimethylazanium?
The IUPAC name of dihydrogen borate;trimethylazanium (CID 142675520) is dihydrogen borate;trimethylazanium.
What is the SMILES notation for dihydrogen borate;trimethylazanium?
The canonical SMILES for dihydrogen borate;trimethylazanium is C[NH+](C)C.[O-]B(O)O.
What is the InChIKey of dihydrogen borate;trimethylazanium?
The InChIKey is FZZGAKVLPWYYIU-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N.BH2O3/c1-4(2)3;2-1(3)4/h1-3H3;2-3H/q;-1/p+1.
What are the key properties of dihydrogen borate;trimethylazanium?
dihydrogen borate;trimethylazanium has a molecular weight of 120.94 g/mol, XLogP of -3.92, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydrogen borate;trimethylazanium is sourced from PubChem (CID 142675520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).