C23H20N6O2 — CID 142675949
[5-benzyl-2-(2-ethylphenyl)-7-methyl-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide (PubChem CID 142675949) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is [5-benzyl-2-(2-ethylphenyl)-7-methyl-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide.
| Compound Name | [5-benzyl-2-(2-ethylphenyl)-7-methyl-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide |
|---|---|
| PubChem CID | 142675949 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [5-benzyl-2-(2-ethylphenyl)-7-methyl-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide |
| SMILES | CCc1ccccc1-n1nc2c(n/c1=N\C#N)C(Cc1ccccc1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C23H20N6O2/c1-3-16-11-7-8-12-18(16)29-23(25-14-24)26-19-17(13-15-9-5-4-6-10-15)21(30)28(2)22(31)20(19)27-29/h4-12,17H,3,13H2,1-2H3/b25-23+ |
| InChIKey | PCWGLEIHEUOKRT-WJTDDFOZSA-N |
| XLogP | 2.15 |
| TPSA | 104.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|