About ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate
ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate (PubChem CID 142677162) has the molecular formula C14H13ClF2N2O5
and a molecular weight of 362.72 g/mol. Its IUPAC name is ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate |
| PubChem CID | 142677162 |
| Molecular Formula | C14H13ClF2N2O5 |
| Molecular Weight | 362.72 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/N(C)C)C(=O)c1cc(F)c(F)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C14H13ClF2N2O5/c1-4-24-14(21)8(6-18(2)3)13(20)7-5-9(16)11(17)12(10(7)15)19(22)23/h5-6H,4H2,1-3H3/b8-6+ |
| InChIKey | DKEYOHYEQHGPMY-SOFGYWHQSA-N |
| XLogP | 2.72 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.72 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate?
The IUPAC name of ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate (CID 142677162) is ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate.
What is the SMILES notation for ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate?
The canonical SMILES for ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate is CCOC(=O)/C(=C/N(C)C)C(=O)c1cc(F)c(F)c([N+](=O)[O-])c1Cl.
What is the InChIKey of ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate?
The InChIKey is DKEYOHYEQHGPMY-SOFGYWHQSA-N. The full InChI is InChI=1S/C14H13ClF2N2O5/c1-4-24-14(21)8(6-18(2)3)13(20)7-5-9(16)11(17)12(10(7)15)19(22)23/h5-6H,4H2,1-3H3/b8-6+.
What are the key properties of ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate?
ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate has a molecular weight of 362.72 g/mol, XLogP of 2.72, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-(2-chloro-4,5-difluoro-3-nitrobenzoyl)-3-(dimethylamino)prop-2-enoate is sourced from PubChem (CID 142677162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).