About ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate
ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 142677617) has the molecular formula C26H30FNO4
and a molecular weight of 439.53 g/mol. Its IUPAC name is ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate.
Molecular Properties
| Compound Name | ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate |
| PubChem CID | 142677617 |
| Molecular Formula | C26H30FNO4 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | C=CC(O)CC(O)C(C(=O)OCC)c1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C |
| InChI | InChI=1S/C26H30FNO4/c1-5-19(29)15-22(30)24(26(31)32-6-2)25-23(17-11-13-18(27)14-12-17)20-9-7-8-10-21(20)28(25)16(3)4/h5,7-14,16,19,22,24,29-30H,1,6,15H2,2-4H3 |
| InChIKey | OIZGRUVEROIEMQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate?
The IUPAC name of ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate (CID 142677617) is ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate.
What is the SMILES notation for ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate?
The canonical SMILES for ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate is C=CC(O)CC(O)C(C(=O)OCC)c1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C.
What is the InChIKey of ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate?
The InChIKey is OIZGRUVEROIEMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30FNO4/c1-5-19(29)15-22(30)24(26(31)32-6-2)25-23(17-11-13-18(27)14-12-17)20-9-7-8-10-21(20)28(25)16(3)4/h5,7-14,16,19,22,24,29-30H,1,6,15H2,2-4H3.
What are the key properties of ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate?
ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate has a molecular weight of 439.53 g/mol, XLogP of 4.97, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate is sourced from PubChem (CID 142677617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).