C27H25FN4O — CID 142677987
[5-(2-fluorophenyl)-1-(4-phenylphenyl)pyrazol-4-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 142677987) has the molecular formula C27H25FN4O and a molecular weight of 440.52 g/mol. Its IUPAC name is [5-(2-fluorophenyl)-1-(4-phenylphenyl)pyrazol-4-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [5-(2-fluorophenyl)-1-(4-phenylphenyl)pyrazol-4-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 142677987 |
| Molecular Formula | C27H25FN4O |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [5-(2-fluorophenyl)-1-(4-phenylphenyl)pyrazol-4-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cnn(-c3ccc(-c4ccccc4)cc3)c2-c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H25FN4O/c1-30-15-17-31(18-16-30)27(33)24-19-29-32(26(24)23-9-5-6-10-25(23)28)22-13-11-21(12-14-22)20-7-3-2-4-8-20/h2-14,19H,15-18H2,1H3 |
| InChIKey | WGPQOLTWAKRNEG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |