C28H30FN5O2 — CID 142678016
tert-butyl N-[2-[[5-(2-fluorophenyl)-1-(6-phenyl-3-pyridinyl)pyrazol-4-yl]methylamino]ethyl]carbamate (PubChem CID 142678016) has the molecular formula C28H30FN5O2 and a molecular weight of 487.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(2-fluorophenyl)-1-(6-phenyl-3-pyridinyl)pyrazol-4-yl]methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(2-fluorophenyl)-1-(6-phenyl-3-pyridinyl)pyrazol-4-yl]methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 142678016 |
| Molecular Formula | C28H30FN5O2 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | tert-butyl N-[2-[[5-(2-fluorophenyl)-1-(6-phenyl-3-pyridinyl)pyrazol-4-yl]methylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNCc1cnn(-c2ccc(-c3ccccc3)nc2)c1-c1ccccc1F |
| InChI | InChI=1S/C28H30FN5O2/c1-28(2,3)36-27(35)31-16-15-30-17-21-18-33-34(26(21)23-11-7-8-12-24(23)29)22-13-14-25(32-19-22)20-9-5-4-6-10-20/h4-14,18-19,30H,15-17H2,1-3H3,(H,31,35) |
| InChIKey | JSMVBTQUUCRUNA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|