C19H20ClN3O4S3 — CID 142679225
4-(5-chloro-2H-thiophen-5-yl)-N-[4-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 142679225) has the molecular formula C19H20ClN3O4S3 and a molecular weight of 486.04 g/mol. Its IUPAC name is 4-(5-chloro-2H-thiophen-5-yl)-N-[4-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 4-(5-chloro-2H-thiophen-5-yl)-N-[4-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142679225 |
| Molecular Formula | C19H20ClN3O4S3 |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | 4-(5-chloro-2H-thiophen-5-yl)-N-[4-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | O=C(Cc1csc(NS(=O)(=O)c2ccc(C3(Cl)C=CCS3)cc2)n1)N1CCOCC1 |
| InChI | InChI=1S/C19H20ClN3O4S3/c20-19(6-1-11-29-19)14-2-4-16(5-3-14)30(25,26)22-18-21-15(13-28-18)12-17(24)23-7-9-27-10-8-23/h1-6,13H,7-12H2,(H,21,22) |
| InChIKey | GEKQACIQIOICIO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|