C29H30N4O — CID 142679837
1-[3-[(3-naphthalen-1-yl-1,2-oxazol-5-yl)methylamino]propyl]-4-phenylpiperidine-4-carbonitrile (PubChem CID 142679837) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is 1-[3-[(3-naphthalen-1-yl-1,2-oxazol-5-yl)methylamino]propyl]-4-phenylpiperidine-4-carbonitrile.
| Compound Name | 1-[3-[(3-naphthalen-1-yl-1,2-oxazol-5-yl)methylamino]propyl]-4-phenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 142679837 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 1-[3-[(3-naphthalen-1-yl-1,2-oxazol-5-yl)methylamino]propyl]-4-phenylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccccc2)CCN(CCCNCc2cc(-c3cccc4ccccc34)no2)CC1 |
| InChI | InChI=1S/C29H30N4O/c30-22-29(24-10-2-1-3-11-24)14-18-33(19-15-29)17-7-16-31-21-25-20-28(32-34-25)27-13-6-9-23-8-4-5-12-26(23)27/h1-6,8-13,20,31H,7,14-19,21H2 |
| InChIKey | VMDHXQMXOIWHSJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|