C31H26FN3O3S — CID 142680307
N-[3-(2-benzylsulfonylpyrimidin-4-yl)-4-phenylmethoxyphenyl]-2-fluoro-4-methylaniline (PubChem CID 142680307) has the molecular formula C31H26FN3O3S and a molecular weight of 539.63 g/mol. Its IUPAC name is N-[3-(2-benzylsulfonylpyrimidin-4-yl)-4-phenylmethoxyphenyl]-2-fluoro-4-methylaniline.
| Compound Name | N-[3-(2-benzylsulfonylpyrimidin-4-yl)-4-phenylmethoxyphenyl]-2-fluoro-4-methylaniline |
|---|---|
| PubChem CID | 142680307 |
| Molecular Formula | C31H26FN3O3S |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | N-[3-(2-benzylsulfonylpyrimidin-4-yl)-4-phenylmethoxyphenyl]-2-fluoro-4-methylaniline |
| SMILES | Cc1ccc(Nc2ccc(OCc3ccccc3)c(-c3ccnc(S(=O)(=O)Cc4ccccc4)n3)c2)c(F)c1 |
| InChI | InChI=1S/C31H26FN3O3S/c1-22-12-14-29(27(32)18-22)34-25-13-15-30(38-20-23-8-4-2-5-9-23)26(19-25)28-16-17-33-31(35-28)39(36,37)21-24-10-6-3-7-11-24/h2-19,34H,20-21H2,1H3 |
| InChIKey | LBNARQJGMYPDFX-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |