C8H13F4O3P — CID 14268063
4-diethoxyphosphoryl-1,1,4,4-tetrafluorobut-1-ene (PubChem CID 14268063) has the molecular formula C8H13F4O3P and a molecular weight of 264.15 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-1,1,4,4-tetrafluorobut-1-ene.
| Compound Name | 4-diethoxyphosphoryl-1,1,4,4-tetrafluorobut-1-ene |
|---|---|
| PubChem CID | 14268063 |
| Molecular Formula | C8H13F4O3P |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 4-diethoxyphosphoryl-1,1,4,4-tetrafluorobut-1-ene |
| SMILES | CCOP(=O)(OCC)C(F)(F)CC=C(F)F |
| InChI | InChI=1S/C8H13F4O3P/c1-3-14-16(13,15-4-2)8(11,12)6-5-7(9)10/h5H,3-4,6H2,1-2H3 |
| InChIKey | YRIVKMZISLVQOR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|