C10H15ClN2O2 — CID 142680777
2-(1-hydroxybutan-2-yl)pyridine-3-carboxamide;hydrochloride (PubChem CID 142680777) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.70 g/mol. Its IUPAC name is 2-(1-hydroxybutan-2-yl)pyridine-3-carboxamide;hydrochloride.
| Compound Name | 2-(1-hydroxybutan-2-yl)pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 142680777 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-(1-hydroxybutan-2-yl)pyridine-3-carboxamide;hydrochloride |
| SMILES | CCC(CO)c1ncccc1C(N)=O.Cl |
| InChI | InChI=1S/C10H14N2O2.ClH/c1-2-7(6-13)9-8(10(11)14)4-3-5-12-9;/h3-5,7,13H,2,6H2,1H3,(H2,11,14);1H |
| InChIKey | CXPZLUHYMDHJRE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |