C34H60OSi — CID 142680846
[3-[3-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]propylidene]-4-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane (PubChem CID 142680846) has the molecular formula C34H60OSi and a molecular weight of 512.94 g/mol. Its IUPAC name is [3-[3-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]propylidene]-4-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [3-[3-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]propylidene]-4-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 142680846 |
| Molecular Formula | C34H60OSi |
| Molecular Weight | 512.94 g/mol |
| Exact Mass | 512.44 |
| IUPAC Name | [3-[3-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]propylidene]-4-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC=C1CCCC2(C)C1CCC2C(C)CCCC(C)C |
| InChI | InChI=1S/C34H60OSi/c1-25(2)14-11-15-27(4)31-21-22-32-28(18-13-23-34(31,32)8)16-12-17-29-24-30(20-19-26(29)3)35-36(9,10)33(5,6)7/h16-17,25,27,30-32H,3,11-15,18-24H2,1-2,4-10H3 |
| InChIKey | MCAYUDDFVCDIDX-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.94 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|