C21H24FN3 — CID 142680937
N-but-3-enyl-N-[2-(4-fluorophenyl)ethyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-1-amine (PubChem CID 142680937) has the molecular formula C21H24FN3 and a molecular weight of 337.44 g/mol. Its IUPAC name is N-but-3-enyl-N-[2-(4-fluorophenyl)ethyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-1-amine.
| Compound Name | N-but-3-enyl-N-[2-(4-fluorophenyl)ethyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-1-amine |
|---|---|
| PubChem CID | 142680937 |
| Molecular Formula | C21H24FN3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-but-3-enyl-N-[2-(4-fluorophenyl)ethyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-1-amine |
| SMILES | C=CCCN(CCc1ccc(F)cc1)n1c(C)c(C)c2ccncc21 |
| InChI | InChI=1S/C21H24FN3/c1-4-5-13-24(14-11-18-6-8-19(22)9-7-18)25-17(3)16(2)20-10-12-23-15-21(20)25/h4,6-10,12,15H,1,5,11,13-14H2,2-3H3 |
| InChIKey | SGXFZOWHJXXYMZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|