C19H17FN2O5S — CID 142681055
8-[(4-fluorophenyl)methoxy]-11,12-dimethyl-10-prop-2-enyl-3,5-dioxa-4λ6-thia-7,10-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),7,11-tetraene 4,4-dioxide (PubChem CID 142681055) has the molecular formula C19H17FN2O5S and a molecular weight of 404.42 g/mol. Its IUPAC name is 8-[(4-fluorophenyl)methoxy]-11,12-dimethyl-10-prop-2-enyl-3,5-dioxa-4λ6-thia-7,10-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),7,11-tetraene 4,4-dioxide.
| Compound Name | 8-[(4-fluorophenyl)methoxy]-11,12-dimethyl-10-prop-2-enyl-3,5-dioxa-4λ6-thia-7,10-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),7,11-tetraene 4,4-dioxide |
|---|---|
| PubChem CID | 142681055 |
| Molecular Formula | C19H17FN2O5S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 8-[(4-fluorophenyl)methoxy]-11,12-dimethyl-10-prop-2-enyl-3,5-dioxa-4λ6-thia-7,10-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),7,11-tetraene 4,4-dioxide |
| SMILES | C=CCn1c(C)c(C)c2c3c(nc(OCc4ccc(F)cc4)c21)OS(=O)(=O)O3 |
| InChI | InChI=1S/C19H17FN2O5S/c1-4-9-22-12(3)11(2)15-16(22)18(21-19-17(15)26-28(23,24)27-19)25-10-13-5-7-14(20)8-6-13/h4-8H,1,9-10H2,2-3H3 |
| InChIKey | PANLOXZLZLKZNX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|