C23H26ClFN4S — CID 142681083
1-[(2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridin-7-yl)methyl]-1-(4-fluorophenyl)-3-prop-2-enylthiourea;hydrochloride (PubChem CID 142681083) has the molecular formula C23H26ClFN4S and a molecular weight of 445.01 g/mol. Its IUPAC name is 1-[(2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridin-7-yl)methyl]-1-(4-fluorophenyl)-3-prop-2-enylthiourea;hydrochloride.
| Compound Name | 1-[(2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridin-7-yl)methyl]-1-(4-fluorophenyl)-3-prop-2-enylthiourea;hydrochloride |
|---|---|
| PubChem CID | 142681083 |
| Molecular Formula | C23H26ClFN4S |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 1-[(2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridin-7-yl)methyl]-1-(4-fluorophenyl)-3-prop-2-enylthiourea;hydrochloride |
| SMILES | C=CCNC(=S)N(Cc1nccc2c(C)c(C)n(CC=C)c12)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C23H25FN4S.ClH/c1-5-12-26-23(29)28(19-9-7-18(24)8-10-19)15-21-22-20(11-13-25-21)16(3)17(4)27(22)14-6-2;/h5-11,13H,1-2,12,14-15H2,3-4H3,(H,26,29);1H |
| InChIKey | CKLLOAROSQFWCA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|