About propan-2-olate;trichlorotitanium(1+)
propan-2-olate;trichlorotitanium(1+) (PubChem CID 14268138) has the molecular formula C3H7Cl3OTi
and a molecular weight of 213.31 g/mol. Its IUPAC name is propan-2-olate;trichlorotitanium(1+).
Molecular Properties
| Compound Name | propan-2-olate;trichlorotitanium(1+) |
| PubChem CID | 14268138 |
| Molecular Formula | C3H7Cl3OTi |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 211.90 |
| IUPAC Name | propan-2-olate;trichlorotitanium(1+) |
| SMILES | CC(C)[O-].Cl[Ti+](Cl)Cl |
| InChI | InChI=1S/C3H7O.3ClH.Ti/c1-3(2)4;;;;/h3H,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | FLALGSYYVIWTFQ-UHFFFAOYSA-K |
| XLogP | 1.82 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-olate;trichlorotitanium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-olate;trichlorotitanium(1+)?
The IUPAC name of propan-2-olate;trichlorotitanium(1+) (CID 14268138) is propan-2-olate;trichlorotitanium(1+).
What is the SMILES notation for propan-2-olate;trichlorotitanium(1+)?
The canonical SMILES for propan-2-olate;trichlorotitanium(1+) is CC(C)[O-].Cl[Ti+](Cl)Cl.
What is the InChIKey of propan-2-olate;trichlorotitanium(1+)?
The InChIKey is FLALGSYYVIWTFQ-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H7O.3ClH.Ti/c1-3(2)4;;;;/h3H,1-2H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of propan-2-olate;trichlorotitanium(1+)?
propan-2-olate;trichlorotitanium(1+) has a molecular weight of 213.31 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-olate;trichlorotitanium(1+) is sourced from PubChem (CID 14268138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).