About (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide
(2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide (PubChem CID 142682374) has the molecular formula C9H12F2N2OS
and a molecular weight of 234.27 g/mol. Its IUPAC name is (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide.
Molecular Properties
| Compound Name | (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide |
| PubChem CID | 142682374 |
| Molecular Formula | C9H12F2N2OS |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide |
| SMILES | C[C@@H](NC(c1cccs1)C(F)F)C(N)=O |
| InChI | InChI=1S/C9H12F2N2OS/c1-5(9(12)14)13-7(8(10)11)6-3-2-4-15-6/h2-5,7-8,13H,1H3,(H2,12,14)/t5-,7?/m1/s1 |
| InChIKey | DSLUVSIKBITVNG-FOUAAFFMSA-N |
| XLogP | 1.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide?
The IUPAC name of (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide (CID 142682374) is (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide.
What is the SMILES notation for (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide?
The canonical SMILES for (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide is C[C@@H](NC(c1cccs1)C(F)F)C(N)=O.
What is the InChIKey of (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide?
The InChIKey is DSLUVSIKBITVNG-FOUAAFFMSA-N. The full InChI is InChI=1S/C9H12F2N2OS/c1-5(9(12)14)13-7(8(10)11)6-3-2-4-15-6/h2-5,7-8,13H,1H3,(H2,12,14)/t5-,7?/m1/s1.
What are the key properties of (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide?
(2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide has a molecular weight of 234.27 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2,2-difluoro-1-thiophen-2-ylethyl)amino]propanamide is sourced from PubChem (CID 142682374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).