About 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide
2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide (PubChem CID 142682491) has the molecular formula C13H8Cl4N2O
and a molecular weight of 350.03 g/mol. Its IUPAC name is 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide.
Molecular Properties
| Compound Name | 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide |
| PubChem CID | 142682491 |
| Molecular Formula | C13H8Cl4N2O |
| Molecular Weight | 350.03 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide |
| SMILES | NC(=O)c1c(Cl)ccc(Cc2ncc(Cl)cc2Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl4N2O/c14-7-4-9(16)10(19-5-7)3-6-1-2-8(15)11(12(6)17)13(18)20/h1-2,4-5H,3H2,(H2,18,20) |
| InChIKey | RRRPSKOUGXUDCY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.03 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide?
The IUPAC name of 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide (CID 142682491) is 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide.
What is the SMILES notation for 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide?
The canonical SMILES for 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide is NC(=O)c1c(Cl)ccc(Cc2ncc(Cl)cc2Cl)c1Cl.
What is the InChIKey of 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide?
The InChIKey is RRRPSKOUGXUDCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl4N2O/c14-7-4-9(16)10(19-5-7)3-6-1-2-8(15)11(12(6)17)13(18)20/h1-2,4-5H,3H2,(H2,18,20).
What are the key properties of 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide?
2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide has a molecular weight of 350.03 g/mol, XLogP of 4.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-3-[(3,5-dichloro-2-pyridinyl)methyl]benzamide is sourced from PubChem (CID 142682491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).