C27H30F3N5O5 — CID 142682889
2-methyl-2-[4-[2-[[4-piperidin-1-yl-6-[4-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]propanoic acid (PubChem CID 142682889) has the molecular formula C27H30F3N5O5 and a molecular weight of 561.56 g/mol. Its IUPAC name is 2-methyl-2-[4-[2-[[4-piperidin-1-yl-6-[4-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[2-[[4-piperidin-1-yl-6-[4-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 142682889 |
| Molecular Formula | C27H30F3N5O5 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 2-methyl-2-[4-[2-[[4-piperidin-1-yl-6-[4-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]propanoic acid |
| SMILES | CC(C)(Oc1ccc(OCCOc2nc(Nc3ccc(C(F)(F)F)cc3)nc(N3CCCCC3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C27H30F3N5O5/c1-26(2,22(36)37)40-21-12-10-20(11-13-21)38-16-17-39-25-33-23(32-24(34-25)35-14-4-3-5-15-35)31-19-8-6-18(7-9-19)27(28,29)30/h6-13H,3-5,14-17H2,1-2H3,(H,36,37)(H,31,32,33,34) |
| InChIKey | PLETXFRQICSLMW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|