C31H29F6N5O5 — CID 142682929
2-[4-[3-[[4,6-bis[[4-(trifluoromethyl)phenyl]methylamino]-1,3,5-triazin-2-yl]oxy]propoxy]phenoxy]propanoic acid (PubChem CID 142682929) has the molecular formula C31H29F6N5O5 and a molecular weight of 665.59 g/mol. Its IUPAC name is 2-[4-[3-[[4,6-bis[[4-(trifluoromethyl)phenyl]methylamino]-1,3,5-triazin-2-yl]oxy]propoxy]phenoxy]propanoic acid.
| Compound Name | 2-[4-[3-[[4,6-bis[[4-(trifluoromethyl)phenyl]methylamino]-1,3,5-triazin-2-yl]oxy]propoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 142682929 |
| Molecular Formula | C31H29F6N5O5 |
| Molecular Weight | 665.59 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | 2-[4-[3-[[4,6-bis[[4-(trifluoromethyl)phenyl]methylamino]-1,3,5-triazin-2-yl]oxy]propoxy]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(OCCCOc2nc(NCc3ccc(C(F)(F)F)cc3)nc(NCc3ccc(C(F)(F)F)cc3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C31H29F6N5O5/c1-19(26(43)44)47-25-13-11-24(12-14-25)45-15-2-16-46-29-41-27(38-17-20-3-7-22(8-4-20)30(32,33)34)40-28(42-29)39-18-21-5-9-23(10-6-21)31(35,36)37/h3-14,19H,2,15-18H2,1H3,(H,43,44)(H2,38,39,40,41,42) |
| InChIKey | DFFSUWJLSXGERC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|