C14H20FNO4S — CID 142683262
3-[butyl-(4-methylphenyl)sulfonylamino]-2-fluoropropanoic acid (PubChem CID 142683262) has the molecular formula C14H20FNO4S and a molecular weight of 317.38 g/mol. Its IUPAC name is 3-[butyl-(4-methylphenyl)sulfonylamino]-2-fluoropropanoic acid.
| Compound Name | 3-[butyl-(4-methylphenyl)sulfonylamino]-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 142683262 |
| Molecular Formula | C14H20FNO4S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3-[butyl-(4-methylphenyl)sulfonylamino]-2-fluoropropanoic acid |
| SMILES | CCCCN(CC(F)C(=O)O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H20FNO4S/c1-3-4-9-16(10-13(15)14(17)18)21(19,20)12-7-5-11(2)6-8-12/h5-8,13H,3-4,9-10H2,1-2H3,(H,17,18) |
| InChIKey | UCYLLACSSPAHRI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |