C18H35N — CID 142684215
(15E)-octadeca-15,17-dien-6-amine (PubChem CID 142684215) has the molecular formula C18H35N and a molecular weight of 265.49 g/mol. Its IUPAC name is (15E)-octadeca-15,17-dien-6-amine.
| Compound Name | (15E)-octadeca-15,17-dien-6-amine |
|---|---|
| PubChem CID | 142684215 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | (15E)-octadeca-15,17-dien-6-amine |
| SMILES | C=C/C=C/CCCCCCCCC(N)CCCCC |
| InChI | InChI=1S/C18H35N/c1-3-5-7-8-9-10-11-12-13-15-17-18(19)16-14-6-4-2/h3,5,7,18H,1,4,6,8-17,19H2,2H3/b7-5+ |
| InChIKey | VJTKKUHQINJWSF-FNORWQNLSA-N |
| XLogP | 5.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|