C15H20BrN3O3Si — CID 142684363
2-trimethylsilylethoxymethyl 3-(3-bromophenyl)-1H-1,2,4-triazole-5-carboxylate (PubChem CID 142684363) has the molecular formula C15H20BrN3O3Si and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-trimethylsilylethoxymethyl 3-(3-bromophenyl)-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | 2-trimethylsilylethoxymethyl 3-(3-bromophenyl)-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 142684363 |
| Molecular Formula | C15H20BrN3O3Si |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-trimethylsilylethoxymethyl 3-(3-bromophenyl)-1H-1,2,4-triazole-5-carboxylate |
| SMILES | C[Si](C)(C)CCOCOC(=O)c1nc(-c2cccc(Br)c2)n[nH]1 |
| InChI | InChI=1S/C15H20BrN3O3Si/c1-23(2,3)8-7-21-10-22-15(20)14-17-13(18-19-14)11-5-4-6-12(16)9-11/h4-6,9H,7-8,10H2,1-3H3,(H,17,18,19) |
| InChIKey | ZKQPQYUCQRBAII-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|