C10H12O — CID 14268500
2,3,4,7-tetrahydroindene-3a-carbaldehyde (PubChem CID 14268500) has the molecular formula C10H12O and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,3,4,7-tetrahydroindene-3a-carbaldehyde.
| Compound Name | 2,3,4,7-tetrahydroindene-3a-carbaldehyde |
|---|---|
| PubChem CID | 14268500 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2,3,4,7-tetrahydroindene-3a-carbaldehyde |
| SMILES | O=CC12CC=CCC1=CCC2 |
| InChI | InChI=1S/C10H12O/c11-8-10-6-2-1-4-9(10)5-3-7-10/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | KBTWRTYYMRUVIN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|