C9H14N2O — CID 142685818
2-methyl-1,2,3,6,7,8-hexahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 142685818) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-methyl-1,2,3,6,7,8-hexahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-methyl-1,2,3,6,7,8-hexahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142685818 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-methyl-1,2,3,6,7,8-hexahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC1CC(=O)N2CCCC=C2N1 |
| InChI | InChI=1S/C9H14N2O/c1-7-6-9(12)11-5-3-2-4-8(11)10-7/h4,7,10H,2-3,5-6H2,1H3 |
| InChIKey | CKSAZAWQMVVBGJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |