C17H20O4S — CID 142685942
[3-(2-hydroxy-5-methylphenyl)-3-phenylpropyl] methanesulfonate (PubChem CID 142685942) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is [3-(2-hydroxy-5-methylphenyl)-3-phenylpropyl] methanesulfonate.
| Compound Name | [3-(2-hydroxy-5-methylphenyl)-3-phenylpropyl] methanesulfonate |
|---|---|
| PubChem CID | 142685942 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | [3-(2-hydroxy-5-methylphenyl)-3-phenylpropyl] methanesulfonate |
| SMILES | Cc1ccc(O)c(C(CCOS(C)(=O)=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H20O4S/c1-13-8-9-17(18)16(12-13)15(10-11-21-22(2,19)20)14-6-4-3-5-7-14/h3-9,12,15,18H,10-11H2,1-2H3 |
| InChIKey | FIUQHAJKPJXNIH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|