C47H73Cl2N2P — CID 142686092
dicyclohexyl-[(4S,5S)-4,5-dibutyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-(4,4-dichlorocyclohexyl)-λ5-phosphane (PubChem CID 142686092) has the molecular formula C47H73Cl2N2P and a molecular weight of 768.00 g/mol. Its IUPAC name is dicyclohexyl-[(4S,5S)-4,5-dibutyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-(4,4-dichlorocyclohexyl)-λ5-phosphane.
| Compound Name | dicyclohexyl-[(4S,5S)-4,5-dibutyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-(4,4-dichlorocyclohexyl)-λ5-phosphane |
|---|---|
| PubChem CID | 142686092 |
| Molecular Formula | C47H73Cl2N2P |
| Molecular Weight | 768.00 g/mol |
| Exact Mass | 766.49 |
| IUPAC Name | dicyclohexyl-[(4S,5S)-4,5-dibutyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-(4,4-dichlorocyclohexyl)-λ5-phosphane |
| SMILES | CCCC[C@H]1[C@H](CCCC)N(c2c(C)cc(C)cc2C)C(=P(C2CCCCC2)(C2CCCCC2)C2CCC(Cl)(Cl)CC2)N1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C47H73Cl2N2P/c1-9-11-23-42-43(24-12-10-2)51(45-37(7)31-34(4)32-38(45)8)46(50(42)44-35(5)29-33(3)30-36(44)6)52(39-19-15-13-16-20-39,40-21-17-14-18-22-40)41-25-27-47(48,49)28-26-41/h29-32,39-43H,9-28H2,1-8H3/t42-,43-/m0/s1 |
| InChIKey | YIZIEHIUJGPJAW-MJPWBCPGSA-N |
| XLogP | 14.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.00 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|