About 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate
2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 142686734) has the molecular formula C15H16N2O2S
and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| PubChem CID | 142686734 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | O=C(OCCc1ccccn1)N1CCc2ccsc2C1 |
| InChI | InChI=1S/C15H16N2O2S/c18-15(19-9-5-13-3-1-2-7-16-13)17-8-4-12-6-10-20-14(12)11-17/h1-3,6-7,10H,4-5,8-9,11H2 |
| InChIKey | TYVNUVQZNGACDL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate?
The IUPAC name of 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (CID 142686734) is 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
What is the SMILES notation for 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate?
The canonical SMILES for 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate is O=C(OCCc1ccccn1)N1CCc2ccsc2C1.
What is the InChIKey of 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate?
The InChIKey is TYVNUVQZNGACDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2S/c18-15(19-9-5-13-3-1-2-7-16-13)17-8-4-12-6-10-20-14(12)11-17/h1-3,6-7,10H,4-5,8-9,11H2.
What are the key properties of 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate?
2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate has a molecular weight of 288.37 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylethyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate is sourced from PubChem (CID 142686734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).