C24H33FN4O3 — CID 142686789
1-(5-fluoro-2-pyridinyl)-3-[(3S,5R)-2-methyl-4-oxo-5-[(phenylmethoxyamino)methyl]nonan-3-yl]urea (PubChem CID 142686789) has the molecular formula C24H33FN4O3 and a molecular weight of 444.55 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-3-[(3S,5R)-2-methyl-4-oxo-5-[(phenylmethoxyamino)methyl]nonan-3-yl]urea.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-3-[(3S,5R)-2-methyl-4-oxo-5-[(phenylmethoxyamino)methyl]nonan-3-yl]urea |
|---|---|
| PubChem CID | 142686789 |
| Molecular Formula | C24H33FN4O3 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-3-[(3S,5R)-2-methyl-4-oxo-5-[(phenylmethoxyamino)methyl]nonan-3-yl]urea |
| SMILES | CCCC[C@H](CNOCc1ccccc1)C(=O)[C@@H](NC(=O)Nc1ccc(F)cn1)C(C)C |
| InChI | InChI=1S/C24H33FN4O3/c1-4-5-11-19(14-27-32-16-18-9-7-6-8-10-18)23(30)22(17(2)3)29-24(31)28-21-13-12-20(25)15-26-21/h6-10,12-13,15,17,19,22,27H,4-5,11,14,16H2,1-3H3,(H2,26,28,29,31)/t19-,22+/m1/s1 |
| InChIKey | UAJQOLFRAQWKNM-KNQAVFIVSA-N |
| XLogP | 4.46 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|