C25H33FN4O4 — CID 142686790
N-[(2R,4S)-2-butyl-4-[(5-fluoro-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-phenylmethoxyformamide (PubChem CID 142686790) has the molecular formula C25H33FN4O4 and a molecular weight of 472.56 g/mol. Its IUPAC name is N-[(2R,4S)-2-butyl-4-[(5-fluoro-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2R,4S)-2-butyl-4-[(5-fluoro-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 142686790 |
| Molecular Formula | C25H33FN4O4 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-[(2R,4S)-2-butyl-4-[(5-fluoro-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-phenylmethoxyformamide |
| SMILES | CCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)[C@@H](NC(=O)Nc1ccc(F)cn1)C(C)C |
| InChI | InChI=1S/C25H33FN4O4/c1-4-5-11-20(15-30(17-31)34-16-19-9-7-6-8-10-19)24(32)23(18(2)3)29-25(33)28-22-13-12-21(26)14-27-22/h6-10,12-14,17-18,20,23H,4-5,11,15-16H2,1-3H3,(H2,27,28,29,33)/t20-,23+/m1/s1 |
| InChIKey | VNAXXMHUKKGJAP-OFNKIYASSA-N |
| XLogP | 4.33 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|