C24H25F3N4O4 — CID 142686805
(E)-N-[3-[4,4-dimethyl-2,5-dioxo-3-(pyridin-4-ylmethyl)imidazolidin-1-yl]-4-(trifluoromethoxy)phenyl]-2-methylpent-2-enamide (PubChem CID 142686805) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is (E)-N-[3-[4,4-dimethyl-2,5-dioxo-3-(pyridin-4-ylmethyl)imidazolidin-1-yl]-4-(trifluoromethoxy)phenyl]-2-methylpent-2-enamide.
| Compound Name | (E)-N-[3-[4,4-dimethyl-2,5-dioxo-3-(pyridin-4-ylmethyl)imidazolidin-1-yl]-4-(trifluoromethoxy)phenyl]-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 142686805 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (E)-N-[3-[4,4-dimethyl-2,5-dioxo-3-(pyridin-4-ylmethyl)imidazolidin-1-yl]-4-(trifluoromethoxy)phenyl]-2-methylpent-2-enamide |
| SMILES | CC/C=C(\C)C(=O)Nc1ccc(OC(F)(F)F)c(N2C(=O)N(Cc3ccncc3)C(C)(C)C2=O)c1 |
| InChI | InChI=1S/C24H25F3N4O4/c1-5-6-15(2)20(32)29-17-7-8-19(35-24(25,26)27)18(13-17)31-21(33)23(3,4)30(22(31)34)14-16-9-11-28-12-10-16/h6-13H,5,14H2,1-4H3,(H,29,32)/b15-6+ |
| InChIKey | VOTUMJDWAXHLAM-GIDUJCDVSA-N |
| XLogP | 5.02 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|