C15H19ClN4O — CID 142686971
4-(2-amino-6-piperidin-3-ylpyrimidin-4-yl)phenol;hydrochloride (PubChem CID 142686971) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 4-(2-amino-6-piperidin-3-ylpyrimidin-4-yl)phenol;hydrochloride.
| Compound Name | 4-(2-amino-6-piperidin-3-ylpyrimidin-4-yl)phenol;hydrochloride |
|---|---|
| PubChem CID | 142686971 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-(2-amino-6-piperidin-3-ylpyrimidin-4-yl)phenol;hydrochloride |
| SMILES | Cl.Nc1nc(-c2ccc(O)cc2)cc(C2CCCNC2)n1 |
| InChI | InChI=1S/C15H18N4O.ClH/c16-15-18-13(10-3-5-12(20)6-4-10)8-14(19-15)11-2-1-7-17-9-11;/h3-6,8,11,17,20H,1-2,7,9H2,(H2,16,18,19);1H |
| InChIKey | YLQOJUINJHFWAV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |