C19H23FN2O6 — CID 142687581
(2R,3S)-3-[4-(4-fluorophenyl)-3,6-dihydroxy-2H-pyridine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 142687581) has the molecular formula C19H23FN2O6 and a molecular weight of 394.40 g/mol. Its IUPAC name is (2R,3S)-3-[4-(4-fluorophenyl)-3,6-dihydroxy-2H-pyridine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (2R,3S)-3-[4-(4-fluorophenyl)-3,6-dihydroxy-2H-pyridine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 142687581 |
| Molecular Formula | C19H23FN2O6 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (2R,3S)-3-[4-(4-fluorophenyl)-3,6-dihydroxy-2H-pyridine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | CC(C)C[C@H](C(=O)N1CC(O)=C(c2ccc(F)cc2)C=C1O)[C@@H](O)C(=O)NO |
| InChI | InChI=1S/C19H23FN2O6/c1-10(2)7-14(17(25)18(26)21-28)19(27)22-9-15(23)13(8-16(22)24)11-3-5-12(20)6-4-11/h3-6,8,10,14,17,23-25,28H,7,9H2,1-2H3,(H,21,26)/t14-,17+/m0/s1 |
| InChIKey | IJFQLMOSUCAARC-WMLDXEAASA-N |
| XLogP | 1.87 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|