sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate

C15H13N2NaO5 — CID 142689334

IUPACsodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate
SMILESO=C(O)c1cc(NCCc2ccccc2[N+](=O)[O-])ccc1[O-].[Na+]
InChIInChI=1S/C15H14N2O5.Na/c18-14-6-5-11(9-12(14)15(19)20)16-8-7-10-3-1-2-4-13(10)17(21)22;/h1-6,9,16,18H,7-8H2,(H,19,20);/q;+1/p-1
InChIKeyFMYMJTMSDWITRC-UHFFFAOYSA-M
MW324.27 g/mol
LogP-0.97
Rot. Bonds6

About sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate

sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate (PubChem CID 142689334) has the molecular formula C15H13N2NaO5 and a molecular weight of 324.27 g/mol. Its IUPAC name is sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate.

Molecular Properties

Compound Namesodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate
PubChem CID142689334
Molecular FormulaC15H13N2NaO5
Molecular Weight324.27 g/mol
Exact Mass324.07
IUPAC Namesodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate
SMILESO=C(O)c1cc(NCCc2ccccc2[N+](=O)[O-])ccc1[O-].[Na+]
InChIInChI=1S/C15H14N2O5.Na/c18-14-6-5-11(9-12(14)15(19)20)16-8-7-10-3-1-2-4-13(10)17(21)22;/h1-6,9,16,18H,7-8H2,(H,19,20);/q;+1/p-1
InChIKeyFMYMJTMSDWITRC-UHFFFAOYSA-M
XLogP-0.97
TPSA115.53 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.27
LogP ≤ 5-0.97
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate?
The IUPAC name of sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate (CID 142689334) is sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate.
What is the SMILES notation for sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate?
The canonical SMILES for sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate is O=C(O)c1cc(NCCc2ccccc2[N+](=O)[O-])ccc1[O-].[Na+].
What is the InChIKey of sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate?
The InChIKey is FMYMJTMSDWITRC-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H14N2O5.Na/c18-14-6-5-11(9-12(14)15(19)20)16-8-7-10-3-1-2-4-13(10)17(21)22;/h1-6,9,16,18H,7-8H2,(H,19,20);/q;+1/p-1.
What are the key properties of sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate?
sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate has a molecular weight of 324.27 g/mol, XLogP of -0.97, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-carboxy-4-[2-(2-nitrophenyl)ethylamino]phenolate is sourced from PubChem (CID 142689334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).