C18H21F4N3O5 — CID 142689686
2-ethyl-N'-[(2R,3S)-2-ethyl-7-fluoro-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-2-hydroxy-N'-(2,2,2-trifluoroethyl)propanediamide (PubChem CID 142689686) has the molecular formula C18H21F4N3O5 and a molecular weight of 435.37 g/mol. Its IUPAC name is 2-ethyl-N'-[(2R,3S)-2-ethyl-7-fluoro-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-2-hydroxy-N'-(2,2,2-trifluoroethyl)propanediamide.
| Compound Name | 2-ethyl-N'-[(2R,3S)-2-ethyl-7-fluoro-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-2-hydroxy-N'-(2,2,2-trifluoroethyl)propanediamide |
|---|---|
| PubChem CID | 142689686 |
| Molecular Formula | C18H21F4N3O5 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-ethyl-N'-[(2R,3S)-2-ethyl-7-fluoro-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-2-hydroxy-N'-(2,2,2-trifluoroethyl)propanediamide |
| SMILES | CC[C@H]1Oc2ccc(F)cc2NC(=O)[C@H]1N(CC(F)(F)F)C(=O)C(O)(CC)C(N)=O |
| InChI | InChI=1S/C18H21F4N3O5/c1-3-11-13(14(26)24-10-7-9(19)5-6-12(10)30-11)25(8-18(20,21)22)16(28)17(29,4-2)15(23)27/h5-7,11,13,29H,3-4,8H2,1-2H3,(H2,23,27)(H,24,26)/t11-,13+,17?/m1/s1 |
| InChIKey | ZFLBEWLCYBFEDI-HWURVSIFSA-N |
| XLogP | 1.32 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|