C17H25FN6O3 — CID 142689796
9-(8-azabicyclo[3.2.1]octan-3-yl)-N,N-diethyl-7-fluoro-2,6-dioxo-8H-purine-3-carboxamide (PubChem CID 142689796) has the molecular formula C17H25FN6O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is 9-(8-azabicyclo[3.2.1]octan-3-yl)-N,N-diethyl-7-fluoro-2,6-dioxo-8H-purine-3-carboxamide.
| Compound Name | 9-(8-azabicyclo[3.2.1]octan-3-yl)-N,N-diethyl-7-fluoro-2,6-dioxo-8H-purine-3-carboxamide |
|---|---|
| PubChem CID | 142689796 |
| Molecular Formula | C17H25FN6O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 9-(8-azabicyclo[3.2.1]octan-3-yl)-N,N-diethyl-7-fluoro-2,6-dioxo-8H-purine-3-carboxamide |
| SMILES | CCN(CC)C(=O)n1c2c(c(=O)[nH]c1=O)N(F)CN2C1CC2CCC(C1)N2 |
| InChI | InChI=1S/C17H25FN6O3/c1-3-21(4-2)17(27)24-15-13(14(25)20-16(24)26)23(18)9-22(15)12-7-10-5-6-11(8-12)19-10/h10-12,19H,3-9H2,1-2H3,(H,20,25,26) |
| InChIKey | DAUOFIBWQSQVJS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|