About N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine
N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine (PubChem CID 142690227) has the molecular formula C10H8F2N2S
and a molecular weight of 226.25 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine |
| PubChem CID | 142690227 |
| Molecular Formula | C10H8F2N2S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine |
| SMILES | Cc1ncc(Nc2cc(F)cc(F)c2)s1 |
| InChI | InChI=1S/C10H8F2N2S/c1-6-13-5-10(15-6)14-9-3-7(11)2-8(12)4-9/h2-5,14H,1H3 |
| InChIKey | WCICHXQTJQRSIT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine?
The IUPAC name of N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine (CID 142690227) is N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine.
What is the SMILES notation for N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine?
The canonical SMILES for N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine is Cc1ncc(Nc2cc(F)cc(F)c2)s1.
What is the InChIKey of N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine?
The InChIKey is WCICHXQTJQRSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N2S/c1-6-13-5-10(15-6)14-9-3-7(11)2-8(12)4-9/h2-5,14H,1H3.
What are the key properties of N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine?
N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine has a molecular weight of 226.25 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-difluorophenyl)-2-methyl-1,3-thiazol-5-amine is sourced from PubChem (CID 142690227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).