C24H26ClN5O2 — CID 142690587
N-[[2-(1-aminoethylideneamino)-5-chlorophenyl]methyl]-2-[5-methyl-3-oxo-2-(2-phenylethyl)pyridazin-4-yl]acetamide (PubChem CID 142690587) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is N-[[2-(1-aminoethylideneamino)-5-chlorophenyl]methyl]-2-[5-methyl-3-oxo-2-(2-phenylethyl)pyridazin-4-yl]acetamide.
| Compound Name | N-[[2-(1-aminoethylideneamino)-5-chlorophenyl]methyl]-2-[5-methyl-3-oxo-2-(2-phenylethyl)pyridazin-4-yl]acetamide |
|---|---|
| PubChem CID | 142690587 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[[2-(1-aminoethylideneamino)-5-chlorophenyl]methyl]-2-[5-methyl-3-oxo-2-(2-phenylethyl)pyridazin-4-yl]acetamide |
| SMILES | C/C(N)=N\c1ccc(Cl)cc1CNC(=O)Cc1c(C)cnn(CCc2ccccc2)c1=O |
| InChI | InChI=1S/C24H26ClN5O2/c1-16-14-28-30(11-10-18-6-4-3-5-7-18)24(32)21(16)13-23(31)27-15-19-12-20(25)8-9-22(19)29-17(2)26/h3-9,12,14H,10-11,13,15H2,1-2H3,(H2,26,29)(H,27,31) |
| InChIKey | QBTQQMMUGNDSPW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|