C34H40O8P2 — CID 142692169
[2-[2-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane-8-carbonyl)phenyl]phenyl]-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl)methanone (PubChem CID 142692169) has the molecular formula C34H40O8P2 and a molecular weight of 638.63 g/mol. Its IUPAC name is [2-[2-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane-8-carbonyl)phenyl]phenyl]-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl)methanone.
| Compound Name | [2-[2-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane-8-carbonyl)phenyl]phenyl]-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl)methanone |
|---|---|
| PubChem CID | 142692169 |
| Molecular Formula | C34H40O8P2 |
| Molecular Weight | 638.63 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | [2-[2-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane-8-carbonyl)phenyl]phenyl]-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl)methanone |
| SMILES | CC12CC3(C)OC(C)(CC(C)(O1)P3C(=O)c1ccccc1-c1ccccc1C(=O)P1C3(C)CC4(C)OC(C)(CC1(C)O4)O3)O2 |
| InChI | InChI=1S/C34H40O8P2/c1-27-17-31(5)40-28(2,37-27)18-32(6,39-27)43(31)25(35)23-15-11-9-13-21(23)22-14-10-12-16-24(22)26(36)44-33(7)19-29(3)38-30(4,42-33)20-34(44,8)41-29/h9-16H,17-20H2,1-8H3 |
| InChIKey | XDNSSGVUHQYPSJ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.63 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|