C31H27FN4O5 — CID 142692199
5-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-4-(2-methoxyethylamino)-2-oxo-1-phenylpyridine-3-carboxamide (PubChem CID 142692199) has the molecular formula C31H27FN4O5 and a molecular weight of 554.58 g/mol. Its IUPAC name is 5-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-4-(2-methoxyethylamino)-2-oxo-1-phenylpyridine-3-carboxamide.
| Compound Name | 5-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-4-(2-methoxyethylamino)-2-oxo-1-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 142692199 |
| Molecular Formula | C31H27FN4O5 |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 5-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-4-(2-methoxyethylamino)-2-oxo-1-phenylpyridine-3-carboxamide |
| SMILES | COCCNc1c(-c2ccc(Oc3ccnc4cc(OC)ccc34)c(F)c2)cn(-c2ccccc2)c(=O)c1C(N)=O |
| InChI | InChI=1S/C31H27FN4O5/c1-39-15-14-35-29-23(18-36(20-6-4-3-5-7-20)31(38)28(29)30(33)37)19-8-11-27(24(32)16-19)41-26-12-13-34-25-17-21(40-2)9-10-22(25)26/h3-13,16-18,35H,14-15H2,1-2H3,(H2,33,37) |
| InChIKey | IUDVPGFEHJTNST-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|