C23H23N3O3 — CID 142692256
3-(2-phenylethynyl)-2-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methoxy]pyrido[2,3-b]pyrazine (PubChem CID 142692256) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 3-(2-phenylethynyl)-2-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methoxy]pyrido[2,3-b]pyrazine.
| Compound Name | 3-(2-phenylethynyl)-2-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methoxy]pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 142692256 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3-(2-phenylethynyl)-2-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methoxy]pyrido[2,3-b]pyrazine |
| SMILES | CC1(COc2nc3cccnc3nc2C#Cc2ccccc2)COC(C)(C)OC1 |
| InChI | InChI=1S/C23H23N3O3/c1-22(2)28-15-23(3,16-29-22)14-27-21-19(12-11-17-8-5-4-6-9-17)25-20-18(26-21)10-7-13-24-20/h4-10,13H,14-16H2,1-3H3 |
| InChIKey | OZOUQHZUGGWPDX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|