C29H27F3N4O2 — CID 142692270
N,N-dipropyl-4-[2-[2-[[4-(trifluoromethoxy)phenyl]methoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]aniline (PubChem CID 142692270) has the molecular formula C29H27F3N4O2 and a molecular weight of 520.56 g/mol. Its IUPAC name is N,N-dipropyl-4-[2-[2-[[4-(trifluoromethoxy)phenyl]methoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]aniline.
| Compound Name | N,N-dipropyl-4-[2-[2-[[4-(trifluoromethoxy)phenyl]methoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]aniline |
|---|---|
| PubChem CID | 142692270 |
| Molecular Formula | C29H27F3N4O2 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N,N-dipropyl-4-[2-[2-[[4-(trifluoromethoxy)phenyl]methoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]aniline |
| SMILES | CCCN(CCC)c1ccc(C#Cc2nc3ncccc3nc2OCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H27F3N4O2/c1-3-18-36(19-4-2)23-12-7-21(8-13-23)11-16-26-28(35-25-6-5-17-33-27(25)34-26)37-20-22-9-14-24(15-10-22)38-29(30,31)32/h5-10,12-15,17H,3-4,18-20H2,1-2H3 |
| InChIKey | QLLNYBXVUGOWEH-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|