C25H16N6O — CID 142692301
4-[2-[2-[2-(1H-benzimidazol-2-yl)ethoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]benzonitrile (PubChem CID 142692301) has the molecular formula C25H16N6O and a molecular weight of 416.44 g/mol. Its IUPAC name is 4-[2-[2-[2-(1H-benzimidazol-2-yl)ethoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]benzonitrile.
| Compound Name | 4-[2-[2-[2-(1H-benzimidazol-2-yl)ethoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 142692301 |
| Molecular Formula | C25H16N6O |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 4-[2-[2-[2-(1H-benzimidazol-2-yl)ethoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]benzonitrile |
| SMILES | N#Cc1ccc(C#Cc2nc3ncccc3nc2OCCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C25H16N6O/c26-16-18-9-7-17(8-10-18)11-12-22-25(31-21-6-3-14-27-24(21)30-22)32-15-13-23-28-19-4-1-2-5-20(19)29-23/h1-10,14H,13,15H2,(H,28,29) |
| InChIKey | HPWPTBBUTGAMTI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|