C36H37N5O — CID 142692404
3-[2-[2-[(2S)-2-(dibenzylamino)-3-methylbutoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]-N,N-dimethylaniline (PubChem CID 142692404) has the molecular formula C36H37N5O and a molecular weight of 555.73 g/mol. Its IUPAC name is 3-[2-[2-[(2S)-2-(dibenzylamino)-3-methylbutoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]-N,N-dimethylaniline.
| Compound Name | 3-[2-[2-[(2S)-2-(dibenzylamino)-3-methylbutoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 142692404 |
| Molecular Formula | C36H37N5O |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | 3-[2-[2-[(2S)-2-(dibenzylamino)-3-methylbutoxy]pyrido[2,3-b]pyrazin-3-yl]ethynyl]-N,N-dimethylaniline |
| SMILES | CC(C)[C@@H](COc1nc2cccnc2nc1C#Cc1cccc(N(C)C)c1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H37N5O/c1-27(2)34(41(24-29-13-7-5-8-14-29)25-30-15-9-6-10-16-30)26-42-36-33(38-35-32(39-36)19-12-22-37-35)21-20-28-17-11-18-31(23-28)40(3)4/h5-19,22-23,27,34H,24-26H2,1-4H3/t34-/m1/s1 |
| InChIKey | QHYCXUZNQNMHRO-UUWRZZSWSA-N |
| XLogP | 6.60 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|